C15H27NO — CID 103277558
azepan-2-yl-(3,5-dimethylcyclohex-3-en-1-yl)methanol (PubChem CID 103277558) has the molecular formula C15H27NO and a molecular weight of 237.39 g/mol. Its IUPAC name is azepan-2-yl-(3,5-dimethylcyclohex-3-en-1-yl)methanol.
| Compound Name | azepan-2-yl-(3,5-dimethylcyclohex-3-en-1-yl)methanol |
|---|---|
| PubChem CID | 103277558 |
| Molecular Formula | C15H27NO |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.21 |
| IUPAC Name | azepan-2-yl-(3,5-dimethylcyclohex-3-en-1-yl)methanol |
| SMILES | CC1=CC(C)CC(C(O)C2CCCCCN2)C1 |
| InChI | InChI=1S/C15H27NO/c1-11-8-12(2)10-13(9-11)15(17)14-6-4-3-5-7-16-14/h8,11,13-17H,3-7,9-10H2,1-2H3 |
| InChIKey | NPRPSTRPVJBLLZ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|