C10H11BrFN3 — CID 103295608
N-(2-bromoethyl)-6-fluoro-N-methyl-1H-benzimidazol-2-amine (PubChem CID 103295608) has the molecular formula C10H11BrFN3 and a molecular weight of 272.12 g/mol. Its IUPAC name is N-(2-bromoethyl)-6-fluoro-N-methyl-1H-benzimidazol-2-amine.
| Compound Name | N-(2-bromoethyl)-6-fluoro-N-methyl-1H-benzimidazol-2-amine |
|---|---|
| PubChem CID | 103295608 |
| Molecular Formula | C10H11BrFN3 |
| Molecular Weight | 272.12 g/mol |
| Exact Mass | 271.01 |
| IUPAC Name | N-(2-bromoethyl)-6-fluoro-N-methyl-1H-benzimidazol-2-amine |
| SMILES | CN(CCBr)c1nc2ccc(F)cc2[nH]1 |
| InChI | InChI=1S/C10H11BrFN3/c1-15(5-4-11)10-13-8-3-2-7(12)6-9(8)14-10/h2-3,6H,4-5H2,1H3,(H,13,14) |
| InChIKey | NGQIREIWEIMROC-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.12 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|