C10H21NS — CID 10330096
N,N-dimethyl-3-pent-4-enylsulfanylpropan-1-amine (PubChem CID 10330096) has the molecular formula C10H21NS and a molecular weight of 187.35 g/mol. Its IUPAC name is N,N-dimethyl-3-pent-4-enylsulfanylpropan-1-amine.
| Compound Name | N,N-dimethyl-3-pent-4-enylsulfanylpropan-1-amine |
|---|---|
| PubChem CID | 10330096 |
| Molecular Formula | C10H21NS |
| Molecular Weight | 187.35 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | N,N-dimethyl-3-pent-4-enylsulfanylpropan-1-amine |
| SMILES | C=CCCCSCCCN(C)C |
| InChI | InChI=1S/C10H21NS/c1-4-5-6-9-12-10-7-8-11(2)3/h4H,1,5-10H2,2-3H3 |
| InChIKey | RHXIZUCPVNXANC-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.35 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|