C9H14O5 — CID 10330476
methyl (Z)-3-[(3S,5S)-5-ethoxydioxolan-3-yl]prop-2-enoate (PubChem CID 10330476) has the molecular formula C9H14O5 and a molecular weight of 202.21 g/mol. Its IUPAC name is methyl (Z)-3-[(3S,5S)-5-ethoxydioxolan-3-yl]prop-2-enoate.
| Compound Name | methyl (Z)-3-[(3S,5S)-5-ethoxydioxolan-3-yl]prop-2-enoate |
|---|---|
| PubChem CID | 10330476 |
| Molecular Formula | C9H14O5 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | methyl (Z)-3-[(3S,5S)-5-ethoxydioxolan-3-yl]prop-2-enoate |
| SMILES | CCO[C@@H]1C[C@@H](/C=C\C(=O)OC)OO1 |
| InChI | InChI=1S/C9H14O5/c1-3-12-9-6-7(13-14-9)4-5-8(10)11-2/h4-5,7,9H,3,6H2,1-2H3/b5-4-/t7-,9+/m1/s1 |
| InChIKey | QDQJKVIBXYFEKN-NRTJZSHXSA-N |
| XLogP | 0.80 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|