C8H11F6N — CID 103311757
1,1,1-trifluoro-N-methyl-2-(trifluoromethyl)hex-5-en-3-amine (PubChem CID 103311757) has the molecular formula C8H11F6N and a molecular weight of 235.17 g/mol. Its IUPAC name is 1,1,1-trifluoro-N-methyl-2-(trifluoromethyl)hex-5-en-3-amine.
| Compound Name | 1,1,1-trifluoro-N-methyl-2-(trifluoromethyl)hex-5-en-3-amine |
|---|---|
| PubChem CID | 103311757 |
| Molecular Formula | C8H11F6N |
| Molecular Weight | 235.17 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 1,1,1-trifluoro-N-methyl-2-(trifluoromethyl)hex-5-en-3-amine |
| SMILES | C=CCC(NC)C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H11F6N/c1-3-4-5(15-2)6(7(9,10)11)8(12,13)14/h3,5-6,15H,1,4H2,2H3 |
| InChIKey | NMTSIJVWZBWSCY-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.17 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|