C12H20F6N2 — CID 103312827
[1-(4-ethylcyclohexyl)-3,3,3-trifluoro-2-(trifluoromethyl)propyl]hydrazine (PubChem CID 103312827) has the molecular formula C12H20F6N2 and a molecular weight of 306.29 g/mol. Its IUPAC name is [1-(4-ethylcyclohexyl)-3,3,3-trifluoro-2-(trifluoromethyl)propyl]hydrazine.
| Compound Name | [1-(4-ethylcyclohexyl)-3,3,3-trifluoro-2-(trifluoromethyl)propyl]hydrazine |
|---|---|
| PubChem CID | 103312827 |
| Molecular Formula | C12H20F6N2 |
| Molecular Weight | 306.29 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | [1-(4-ethylcyclohexyl)-3,3,3-trifluoro-2-(trifluoromethyl)propyl]hydrazine |
| SMILES | CCC1CCC(C(NN)C(C(F)(F)F)C(F)(F)F)CC1 |
| InChI | InChI=1S/C12H20F6N2/c1-2-7-3-5-8(6-4-7)9(20-19)10(11(13,14)15)12(16,17)18/h7-10,20H,2-6,19H2,1H3 |
| InChIKey | QTDHMNLIACZJSJ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.29 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|