C16H22N4 — CID 103314260
3-(3,5-diethyl-1,2,4-triazol-1-yl)-2,3,4,5-tetrahydro-1H-1-benzazepine (PubChem CID 103314260) has the molecular formula C16H22N4 and a molecular weight of 270.38 g/mol. Its IUPAC name is 3-(3,5-diethyl-1,2,4-triazol-1-yl)-2,3,4,5-tetrahydro-1H-1-benzazepine.
| Compound Name | 3-(3,5-diethyl-1,2,4-triazol-1-yl)-2,3,4,5-tetrahydro-1H-1-benzazepine |
|---|---|
| PubChem CID | 103314260 |
| Molecular Formula | C16H22N4 |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | 3-(3,5-diethyl-1,2,4-triazol-1-yl)-2,3,4,5-tetrahydro-1H-1-benzazepine |
| SMILES | CCc1nc(CC)n(C2CCc3ccccc3NC2)n1 |
| InChI | InChI=1S/C16H22N4/c1-3-15-18-16(4-2)20(19-15)13-10-9-12-7-5-6-8-14(12)17-11-13/h5-8,13,17H,3-4,9-11H2,1-2H3 |
| InChIKey | SMZVGIBWIPZZJJ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |