C13H13ClN4O2S — CID 103322008
4-(2-chloro-6-methylthieno[2,3-d]pyrimidin-4-yl)-3,3-dimethylpiperazine-2,6-dione (PubChem CID 103322008) has the molecular formula C13H13ClN4O2S and a molecular weight of 324.79 g/mol. Its IUPAC name is 4-(2-chloro-6-methylthieno[2,3-d]pyrimidin-4-yl)-3,3-dimethylpiperazine-2,6-dione.
| Compound Name | 4-(2-chloro-6-methylthieno[2,3-d]pyrimidin-4-yl)-3,3-dimethylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 103322008 |
| Molecular Formula | C13H13ClN4O2S |
| Molecular Weight | 324.79 g/mol |
| Exact Mass | 324.04 |
| IUPAC Name | 4-(2-chloro-6-methylthieno[2,3-d]pyrimidin-4-yl)-3,3-dimethylpiperazine-2,6-dione |
| SMILES | Cc1cc2c(N3CC(=O)NC(=O)C3(C)C)nc(Cl)nc2s1 |
| InChI | InChI=1S/C13H13ClN4O2S/c1-6-4-7-9(16-12(14)17-10(7)21-6)18-5-8(19)15-11(20)13(18,2)3/h4H,5H2,1-3H3,(H,15,19,20) |
| InChIKey | URCFSONGKWPLMU-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.79 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|