C14H10N4O2S — CID 103331744
4-(2-aminothieno[2,3-d]pyrimidin-4-yl)oxy-3-methoxybenzonitrile (PubChem CID 103331744) has the molecular formula C14H10N4O2S and a molecular weight of 298.33 g/mol. Its IUPAC name is 4-(2-aminothieno[2,3-d]pyrimidin-4-yl)oxy-3-methoxybenzonitrile.
| Compound Name | 4-(2-aminothieno[2,3-d]pyrimidin-4-yl)oxy-3-methoxybenzonitrile |
|---|---|
| PubChem CID | 103331744 |
| Molecular Formula | C14H10N4O2S |
| Molecular Weight | 298.33 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | 4-(2-aminothieno[2,3-d]pyrimidin-4-yl)oxy-3-methoxybenzonitrile |
| SMILES | COc1cc(C#N)ccc1Oc1nc(N)nc2sccc12 |
| InChI | InChI=1S/C14H10N4O2S/c1-19-11-6-8(7-15)2-3-10(11)20-12-9-4-5-21-13(9)18-14(16)17-12/h2-6H,1H3,(H2,16,17,18) |
| InChIKey | ZSZAWEGBGKQFSA-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 94.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.33 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |