C12H18N6OS — CID 103332950
2-[(2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)-propylamino]-N-methylacetamide (PubChem CID 103332950) has the molecular formula C12H18N6OS and a molecular weight of 294.38 g/mol. Its IUPAC name is 2-[(2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)-propylamino]-N-methylacetamide.
| Compound Name | 2-[(2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)-propylamino]-N-methylacetamide |
|---|---|
| PubChem CID | 103332950 |
| Molecular Formula | C12H18N6OS |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | 2-[(2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)-propylamino]-N-methylacetamide |
| SMILES | CCCN(CC(=O)NC)c1nc(NN)nc2sccc12 |
| InChI | InChI=1S/C12H18N6OS/c1-3-5-18(7-9(19)14-2)10-8-4-6-20-11(8)16-12(15-10)17-13/h4,6H,3,5,7,13H2,1-2H3,(H,14,19)(H,15,16,17) |
| InChIKey | ISZPNSSCDGOMRH-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|