C12H17N5O2S — CID 103335448
4-[[(2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)amino]methyl]oxan-4-ol (PubChem CID 103335448) has the molecular formula C12H17N5O2S and a molecular weight of 295.37 g/mol. Its IUPAC name is 4-[[(2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)amino]methyl]oxan-4-ol.
| Compound Name | 4-[[(2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)amino]methyl]oxan-4-ol |
|---|---|
| PubChem CID | 103335448 |
| Molecular Formula | C12H17N5O2S |
| Molecular Weight | 295.37 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | 4-[[(2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)amino]methyl]oxan-4-ol |
| SMILES | NNc1nc(NCC2(O)CCOCC2)c2ccsc2n1 |
| InChI | InChI=1S/C12H17N5O2S/c13-17-11-15-9(8-1-6-20-10(8)16-11)14-7-12(18)2-4-19-5-3-12/h1,6,18H,2-5,7,13H2,(H2,14,15,16,17) |
| InChIKey | HEUSFDVNHBGVLT-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.37 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|