C10H11N3O2 — CID 103337352
N-(2-cyanoethyl)-N-methyl-4-oxo-1H-pyridine-3-carboxamide (PubChem CID 103337352) has the molecular formula C10H11N3O2 and a molecular weight of 205.22 g/mol. Its IUPAC name is N-(2-cyanoethyl)-N-methyl-4-oxo-1H-pyridine-3-carboxamide.
| Compound Name | N-(2-cyanoethyl)-N-methyl-4-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 103337352 |
| Molecular Formula | C10H11N3O2 |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | N-(2-cyanoethyl)-N-methyl-4-oxo-1H-pyridine-3-carboxamide |
| SMILES | CN(CCC#N)C(=O)c1c[nH]ccc1=O |
| InChI | InChI=1S/C10H11N3O2/c1-13(6-2-4-11)10(15)8-7-12-5-3-9(8)14/h3,5,7H,2,6H2,1H3,(H,12,14) |
| InChIKey | AFEIJANBRNWUKK-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |