C13H19NO5S — CID 103342929
methyl 2-[(5-methylfuran-2-yl)methylsulfamoyl]cyclopentane-1-carboxylate (PubChem CID 103342929) has the molecular formula C13H19NO5S and a molecular weight of 301.36 g/mol. Its IUPAC name is methyl 2-[(5-methylfuran-2-yl)methylsulfamoyl]cyclopentane-1-carboxylate.
| Compound Name | methyl 2-[(5-methylfuran-2-yl)methylsulfamoyl]cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 103342929 |
| Molecular Formula | C13H19NO5S |
| Molecular Weight | 301.36 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | methyl 2-[(5-methylfuran-2-yl)methylsulfamoyl]cyclopentane-1-carboxylate |
| SMILES | COC(=O)C1CCCC1S(=O)(=O)NCc1ccc(C)o1 |
| InChI | InChI=1S/C13H19NO5S/c1-9-6-7-10(19-9)8-14-20(16,17)12-5-3-4-11(12)13(15)18-2/h6-7,11-12,14H,3-5,8H2,1-2H3 |
| InChIKey | YUGRHWWRVRMIIP-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.36 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |