C17H18N4O — CID 10334633
propyl 5-(benzylamino)-N-cyanopyridine-3-carboximidate (PubChem CID 10334633) has the molecular formula C17H18N4O and a molecular weight of 294.36 g/mol. Its IUPAC name is propyl 5-(benzylamino)-N-cyanopyridine-3-carboximidate.
| Compound Name | propyl 5-(benzylamino)-N-cyanopyridine-3-carboximidate |
|---|---|
| PubChem CID | 10334633 |
| Molecular Formula | C17H18N4O |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | propyl 5-(benzylamino)-N-cyanopyridine-3-carboximidate |
| SMILES | CCCO/C(=N\C#N)c1cncc(NCc2ccccc2)c1 |
| InChI | InChI=1S/C17H18N4O/c1-2-8-22-17(21-13-18)15-9-16(12-19-11-15)20-10-14-6-4-3-5-7-14/h3-7,9,11-12,20H,2,8,10H2,1H3/b21-17- |
| InChIKey | CEPJGMSPBVBAPJ-FXBPSFAMSA-N |
| XLogP | 3.35 |
| TPSA | 70.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|