C16H17ClO4 — CID 10335470
ethyl (2E,4E)-6-(5-chloro-2-methoxyphenyl)-3-methyl-6-oxohexa-2,4-dienoate (PubChem CID 10335470) has the molecular formula C16H17ClO4 and a molecular weight of 308.76 g/mol. Its IUPAC name is ethyl (2E,4E)-6-(5-chloro-2-methoxyphenyl)-3-methyl-6-oxohexa-2,4-dienoate.
| Compound Name | ethyl (2E,4E)-6-(5-chloro-2-methoxyphenyl)-3-methyl-6-oxohexa-2,4-dienoate |
|---|---|
| PubChem CID | 10335470 |
| Molecular Formula | C16H17ClO4 |
| Molecular Weight | 308.76 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | ethyl (2E,4E)-6-(5-chloro-2-methoxyphenyl)-3-methyl-6-oxohexa-2,4-dienoate |
| SMILES | CCOC(=O)/C=C(C)/C=C/C(=O)c1cc(Cl)ccc1OC |
| InChI | InChI=1S/C16H17ClO4/c1-4-21-16(19)9-11(2)5-7-14(18)13-10-12(17)6-8-15(13)20-3/h5-10H,4H2,1-3H3/b7-5+,11-9+ |
| InChIKey | XZJYDNDJEVIFJA-JEGFTUTRSA-N |
| XLogP | 3.60 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.76 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|