C11H9ClF2O3 — CID 103354779
methyl 2-chloro-3-(2,4-difluorophenyl)-3-methyloxirane-2-carboxylate (PubChem CID 103354779) has the molecular formula C11H9ClF2O3 and a molecular weight of 262.64 g/mol. Its IUPAC name is methyl 2-chloro-3-(2,4-difluorophenyl)-3-methyloxirane-2-carboxylate.
| Compound Name | methyl 2-chloro-3-(2,4-difluorophenyl)-3-methyloxirane-2-carboxylate |
|---|---|
| PubChem CID | 103354779 |
| Molecular Formula | C11H9ClF2O3 |
| Molecular Weight | 262.64 g/mol |
| Exact Mass | 262.02 |
| IUPAC Name | methyl 2-chloro-3-(2,4-difluorophenyl)-3-methyloxirane-2-carboxylate |
| SMILES | COC(=O)C1(Cl)OC1(C)c1ccc(F)cc1F |
| InChI | InChI=1S/C11H9ClF2O3/c1-10(11(12,17-10)9(15)16-2)7-4-3-6(13)5-8(7)14/h3-5H,1-2H3 |
| InChIKey | WQRLIUIXBHNNFM-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.64 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|