C19H15N3O2 — CID 10335962
2-[(3-cyanocyclohepta[b]pyrrol-2-yl)amino]-3-phenylpropanoic acid (PubChem CID 10335962) has the molecular formula C19H15N3O2 and a molecular weight of 317.35 g/mol. Its IUPAC name is 2-[(3-cyanocyclohepta[b]pyrrol-2-yl)amino]-3-phenylpropanoic acid.
| Compound Name | 2-[(3-cyanocyclohepta[b]pyrrol-2-yl)amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 10335962 |
| Molecular Formula | C19H15N3O2 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 2-[(3-cyanocyclohepta[b]pyrrol-2-yl)amino]-3-phenylpropanoic acid |
| SMILES | N#Cc1c2cccccc-2nc1NC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C19H15N3O2/c20-12-15-14-9-5-2-6-10-16(14)21-18(15)22-17(19(23)24)11-13-7-3-1-4-8-13/h1-10,17H,11H2,(H,21,22)(H,23,24) |
| InChIKey | PMHPBYQCJOIJEE-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 86.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |