C7H8F3N3S — CID 103368882
3,3,3-trifluoro-2-(imidazol-1-ylmethyl)propanethioamide (PubChem CID 103368882) has the molecular formula C7H8F3N3S and a molecular weight of 223.22 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-(imidazol-1-ylmethyl)propanethioamide.
| Compound Name | 3,3,3-trifluoro-2-(imidazol-1-ylmethyl)propanethioamide |
|---|---|
| PubChem CID | 103368882 |
| Molecular Formula | C7H8F3N3S |
| Molecular Weight | 223.22 g/mol |
| Exact Mass | 223.04 |
| IUPAC Name | 3,3,3-trifluoro-2-(imidazol-1-ylmethyl)propanethioamide |
| SMILES | NC(=S)C(Cn1ccnc1)C(F)(F)F |
| InChI | InChI=1S/C7H8F3N3S/c8-7(9,10)5(6(11)14)3-13-2-1-12-4-13/h1-2,4-5H,3H2,(H2,11,14) |
| InChIKey | MJBCGRUROYBGOI-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.22 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|