C7H11F3N2O2S2 — CID 103368907
2-[(1,1-dioxo-1,2-thiazolidin-2-yl)methyl]-3,3,3-trifluoropropanethioamide (PubChem CID 103368907) has the molecular formula C7H11F3N2O2S2 and a molecular weight of 276.31 g/mol. Its IUPAC name is 2-[(1,1-dioxo-1,2-thiazolidin-2-yl)methyl]-3,3,3-trifluoropropanethioamide.
| Compound Name | 2-[(1,1-dioxo-1,2-thiazolidin-2-yl)methyl]-3,3,3-trifluoropropanethioamide |
|---|---|
| PubChem CID | 103368907 |
| Molecular Formula | C7H11F3N2O2S2 |
| Molecular Weight | 276.31 g/mol |
| Exact Mass | 276.02 |
| IUPAC Name | 2-[(1,1-dioxo-1,2-thiazolidin-2-yl)methyl]-3,3,3-trifluoropropanethioamide |
| SMILES | NC(=S)C(CN1CCCS1(=O)=O)C(F)(F)F |
| InChI | InChI=1S/C7H11F3N2O2S2/c8-7(9,10)5(6(11)15)4-12-2-1-3-16(12,13)14/h5H,1-4H2,(H2,11,15) |
| InChIKey | FCPUYCVHLIYEBP-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.31 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|