C7H13FN2O2S2 — CID 164648872
2-(3-fluoropyrrolidin-1-yl)sulfonylpropanethioamide (PubChem CID 164648872) has the molecular formula C7H13FN2O2S2 and a molecular weight of 240.32 g/mol. Its IUPAC name is 2-(3-fluoropyrrolidin-1-yl)sulfonylpropanethioamide.
| Compound Name | 2-(3-fluoropyrrolidin-1-yl)sulfonylpropanethioamide |
|---|---|
| PubChem CID | 164648872 |
| Molecular Formula | C7H13FN2O2S2 |
| Molecular Weight | 240.32 g/mol |
| Exact Mass | 240.04 |
| IUPAC Name | 2-(3-fluoropyrrolidin-1-yl)sulfonylpropanethioamide |
| SMILES | CC(C(N)=S)S(=O)(=O)N1CCC(F)C1 |
| InChI | InChI=1S/C7H13FN2O2S2/c1-5(7(9)13)14(11,12)10-3-2-6(8)4-10/h5-6H,2-4H2,1H3,(H2,9,13) |
| InChIKey | GNIDPFIOYHJFIF-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.32 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|