C12H15F3N4OS — CID 103369001
3,3,3-trifluoro-2-[(6-oxo-4-pyrrolidin-1-ylpyridazin-1-yl)methyl]propanethioamide (PubChem CID 103369001) has the molecular formula C12H15F3N4OS and a molecular weight of 320.34 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-[(6-oxo-4-pyrrolidin-1-ylpyridazin-1-yl)methyl]propanethioamide.
| Compound Name | 3,3,3-trifluoro-2-[(6-oxo-4-pyrrolidin-1-ylpyridazin-1-yl)methyl]propanethioamide |
|---|---|
| PubChem CID | 103369001 |
| Molecular Formula | C12H15F3N4OS |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | 3,3,3-trifluoro-2-[(6-oxo-4-pyrrolidin-1-ylpyridazin-1-yl)methyl]propanethioamide |
| SMILES | NC(=S)C(Cn1ncc(N2CCCC2)cc1=O)C(F)(F)F |
| InChI | InChI=1S/C12H15F3N4OS/c13-12(14,15)9(11(16)21)7-19-10(20)5-8(6-17-19)18-3-1-2-4-18/h5-6,9H,1-4,7H2,(H2,16,21) |
| InChIKey | KXEIBGICFSPSRK-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|