C11H15F3N4OS — CID 103369003
2-[[4-[ethyl(methyl)amino]-6-oxopyridazin-1-yl]methyl]-3,3,3-trifluoropropanethioamide (PubChem CID 103369003) has the molecular formula C11H15F3N4OS and a molecular weight of 308.33 g/mol. Its IUPAC name is 2-[[4-[ethyl(methyl)amino]-6-oxopyridazin-1-yl]methyl]-3,3,3-trifluoropropanethioamide.
| Compound Name | 2-[[4-[ethyl(methyl)amino]-6-oxopyridazin-1-yl]methyl]-3,3,3-trifluoropropanethioamide |
|---|---|
| PubChem CID | 103369003 |
| Molecular Formula | C11H15F3N4OS |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 2-[[4-[ethyl(methyl)amino]-6-oxopyridazin-1-yl]methyl]-3,3,3-trifluoropropanethioamide |
| SMILES | CCN(C)c1cnn(CC(C(N)=S)C(F)(F)F)c(=O)c1 |
| InChI | InChI=1S/C11H15F3N4OS/c1-3-17(2)7-4-9(19)18(16-5-7)6-8(10(15)20)11(12,13)14/h4-5,8H,3,6H2,1-2H3,(H2,15,20) |
| InChIKey | DOVWQMWJFWFTQI-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|