C12H17F3N4OS — CID 103369004
2-[[4-(diethylamino)-6-oxopyridazin-1-yl]methyl]-3,3,3-trifluoropropanethioamide (PubChem CID 103369004) has the molecular formula C12H17F3N4OS and a molecular weight of 322.36 g/mol. Its IUPAC name is 2-[[4-(diethylamino)-6-oxopyridazin-1-yl]methyl]-3,3,3-trifluoropropanethioamide.
| Compound Name | 2-[[4-(diethylamino)-6-oxopyridazin-1-yl]methyl]-3,3,3-trifluoropropanethioamide |
|---|---|
| PubChem CID | 103369004 |
| Molecular Formula | C12H17F3N4OS |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | 2-[[4-(diethylamino)-6-oxopyridazin-1-yl]methyl]-3,3,3-trifluoropropanethioamide |
| SMILES | CCN(CC)c1cnn(CC(C(N)=S)C(F)(F)F)c(=O)c1 |
| InChI | InChI=1S/C12H17F3N4OS/c1-3-18(4-2)8-5-10(20)19(17-6-8)7-9(11(16)21)12(13,14)15/h5-6,9H,3-4,7H2,1-2H3,(H2,16,21) |
| InChIKey | NKWDPEOHFNMRTA-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|