C10H13F3N4OS — CID 103369002
2-[[4-(dimethylamino)-6-oxopyridazin-1-yl]methyl]-3,3,3-trifluoropropanethioamide (PubChem CID 103369002) has the molecular formula C10H13F3N4OS and a molecular weight of 294.30 g/mol. Its IUPAC name is 2-[[4-(dimethylamino)-6-oxopyridazin-1-yl]methyl]-3,3,3-trifluoropropanethioamide.
| Compound Name | 2-[[4-(dimethylamino)-6-oxopyridazin-1-yl]methyl]-3,3,3-trifluoropropanethioamide |
|---|---|
| PubChem CID | 103369002 |
| Molecular Formula | C10H13F3N4OS |
| Molecular Weight | 294.30 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | 2-[[4-(dimethylamino)-6-oxopyridazin-1-yl]methyl]-3,3,3-trifluoropropanethioamide |
| SMILES | CN(C)c1cnn(CC(C(N)=S)C(F)(F)F)c(=O)c1 |
| InChI | InChI=1S/C10H13F3N4OS/c1-16(2)6-3-8(18)17(15-4-6)5-7(9(14)19)10(11,12)13/h3-4,7H,5H2,1-2H3,(H2,14,19) |
| InChIKey | UHLXJVLOKOFGBO-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.30 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|