C21H23N3O — CID 10336927
4-[(E)-[benzyl-[(1R,2R)-2-hydroxycyclohexyl]hydrazinylidene]methyl]benzonitrile (PubChem CID 10336927) has the molecular formula C21H23N3O and a molecular weight of 333.44 g/mol. Its IUPAC name is 4-[(E)-[benzyl-[(1R,2R)-2-hydroxycyclohexyl]hydrazinylidene]methyl]benzonitrile.
| Compound Name | 4-[(E)-[benzyl-[(1R,2R)-2-hydroxycyclohexyl]hydrazinylidene]methyl]benzonitrile |
|---|---|
| PubChem CID | 10336927 |
| Molecular Formula | C21H23N3O |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.18 |
| IUPAC Name | 4-[(E)-[benzyl-[(1R,2R)-2-hydroxycyclohexyl]hydrazinylidene]methyl]benzonitrile |
| SMILES | N#Cc1ccc(/C=N/N(Cc2ccccc2)[C@@H]2CCCC[C@H]2O)cc1 |
| InChI | InChI=1S/C21H23N3O/c22-14-17-10-12-18(13-11-17)15-23-24(16-19-6-2-1-3-7-19)20-8-4-5-9-21(20)25/h1-3,6-7,10-13,15,20-21,25H,4-5,8-9,16H2/b23-15+/t20-,21-/m1/s1 |
| InChIKey | YBPKZAKUOHGOLB-ASIXBHFTSA-N |
| XLogP | 3.70 |
| TPSA | 59.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|