C20H23ClN2O — CID 10246805
trans-(1R,2R)-2-[benzyl-[(E)-(4-chlorophenyl)methylideneamino]amino]cyclohexan-1-ol (PubChem CID 10246805) has the molecular formula C20H23ClN2O and a molecular weight of 342.87 g/mol. Its IUPAC name is trans-(1R,2R)-2-[benzyl-[(E)-(4-chlorophenyl)methylideneamino]amino]cyclohexan-1-ol.
| Compound Name | trans-(1R,2R)-2-[benzyl-[(E)-(4-chlorophenyl)methylideneamino]amino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 10246805 |
| Molecular Formula | C20H23ClN2O |
| Molecular Weight | 342.87 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | trans-(1R,2R)-2-[benzyl-[(E)-(4-chlorophenyl)methylideneamino]amino]cyclohexan-1-ol |
| SMILES | O[C@@H]1CCCC[C@H]1N(Cc1ccccc1)/N=C/c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H23ClN2O/c21-18-12-10-16(11-13-18)14-22-23(15-17-6-2-1-3-7-17)19-8-4-5-9-20(19)24/h1-3,6-7,10-14,19-20,24H,4-5,8-9,15H2/b22-14+/t19-,20-/m1/s1 |
| InChIKey | CQDPMUQWWXRYCT-CJAKRPKWSA-N |
| XLogP | 4.48 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.87 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|