C10H21F3N4O3S — CID 103369743
2-[[3-[ethyl(methylsulfonyl)amino]propylamino]methyl]-3,3,3-trifluoro-N'-hydroxypropanimidamide (PubChem CID 103369743) has the molecular formula C10H21F3N4O3S and a molecular weight of 334.36 g/mol. Its IUPAC name is 2-[[3-[ethyl(methylsulfonyl)amino]propylamino]methyl]-3,3,3-trifluoro-N'-hydroxypropanimidamide.
| Compound Name | 2-[[3-[ethyl(methylsulfonyl)amino]propylamino]methyl]-3,3,3-trifluoro-N'-hydroxypropanimidamide |
|---|---|
| PubChem CID | 103369743 |
| Molecular Formula | C10H21F3N4O3S |
| Molecular Weight | 334.36 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | 2-[[3-[ethyl(methylsulfonyl)amino]propylamino]methyl]-3,3,3-trifluoro-N'-hydroxypropanimidamide |
| SMILES | CCN(CCCNCC(C(N)=NO)C(F)(F)F)S(C)(=O)=O |
| InChI | InChI=1S/C10H21F3N4O3S/c1-3-17(21(2,19)20)6-4-5-15-7-8(9(14)16-18)10(11,12)13/h8,15,18H,3-7H2,1-2H3,(H2,14,16) |
| InChIKey | HDYFRRVBOIGUDE-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 108.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.36 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|