About S-[2-(3-aminopropylamino)ethyl] ethanethioate;dihydrobromide
S-[2-(3-aminopropylamino)ethyl] ethanethioate;dihydrobromide (PubChem CID 10337177) has the molecular formula C7H18Br2N2OS
and a molecular weight of 338.11 g/mol. Its IUPAC name is S-[2-(3-aminopropylamino)ethyl] ethanethioate;dihydrobromide.
Molecular Properties
| Compound Name | S-[2-(3-aminopropylamino)ethyl] ethanethioate;dihydrobromide |
| PubChem CID | 10337177 |
| Molecular Formula | C7H18Br2N2OS |
| Molecular Weight | 338.11 g/mol |
| Exact Mass | 335.95 |
| IUPAC Name | S-[2-(3-aminopropylamino)ethyl] ethanethioate;dihydrobromide |
| SMILES | Br.Br.CC(=O)SCCNCCCN |
| InChI | InChI=1S/C7H16N2OS.2BrH/c1-7(10)11-6-5-9-4-2-3-8;;/h9H,2-6,8H2,1H3;2*1H |
| InChIKey | UETBBVPGRMLSOW-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.11 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-[2-(3-aminopropylamino)ethyl] ethanethioate;dihydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-[2-(3-aminopropylamino)ethyl] ethanethioate;dihydrobromide?
The IUPAC name of S-[2-(3-aminopropylamino)ethyl] ethanethioate;dihydrobromide (CID 10337177) is S-[2-(3-aminopropylamino)ethyl] ethanethioate;dihydrobromide.
What is the SMILES notation for S-[2-(3-aminopropylamino)ethyl] ethanethioate;dihydrobromide?
The canonical SMILES for S-[2-(3-aminopropylamino)ethyl] ethanethioate;dihydrobromide is Br.Br.CC(=O)SCCNCCCN.
What is the InChIKey of S-[2-(3-aminopropylamino)ethyl] ethanethioate;dihydrobromide?
The InChIKey is UETBBVPGRMLSOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16N2OS.2BrH/c1-7(10)11-6-5-9-4-2-3-8;;/h9H,2-6,8H2,1H3;2*1H.
What are the key properties of S-[2-(3-aminopropylamino)ethyl] ethanethioate;dihydrobromide?
S-[2-(3-aminopropylamino)ethyl] ethanethioate;dihydrobromide has a molecular weight of 338.11 g/mol, XLogP of 1.36, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-[2-(3-aminopropylamino)ethyl] ethanethioate;dihydrobromide is sourced from PubChem (CID 10337177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).