C10H18F3NO2S — CID 103372542
2-(cyclohexylsulfonylmethyl)-3,3,3-trifluoropropan-1-amine (PubChem CID 103372542) has the molecular formula C10H18F3NO2S and a molecular weight of 273.32 g/mol. Its IUPAC name is 2-(cyclohexylsulfonylmethyl)-3,3,3-trifluoropropan-1-amine.
| Compound Name | 2-(cyclohexylsulfonylmethyl)-3,3,3-trifluoropropan-1-amine |
|---|---|
| PubChem CID | 103372542 |
| Molecular Formula | C10H18F3NO2S |
| Molecular Weight | 273.32 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | 2-(cyclohexylsulfonylmethyl)-3,3,3-trifluoropropan-1-amine |
| SMILES | NCC(CS(=O)(=O)C1CCCCC1)C(F)(F)F |
| InChI | InChI=1S/C10H18F3NO2S/c11-10(12,13)8(6-14)7-17(15,16)9-4-2-1-3-5-9/h8-9H,1-7,14H2 |
| InChIKey | SZAARJXQWGZTRE-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.32 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |