C10H18F3NOS — CID 81328376
3-cyclohexylsulfinyl-4,4,4-trifluorobutan-1-amine (PubChem CID 81328376) has the molecular formula C10H18F3NOS and a molecular weight of 257.32 g/mol. Its IUPAC name is 3-cyclohexylsulfinyl-4,4,4-trifluorobutan-1-amine.
| Compound Name | 3-cyclohexylsulfinyl-4,4,4-trifluorobutan-1-amine |
|---|---|
| PubChem CID | 81328376 |
| Molecular Formula | C10H18F3NOS |
| Molecular Weight | 257.32 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | 3-cyclohexylsulfinyl-4,4,4-trifluorobutan-1-amine |
| SMILES | NCCC(S(=O)C1CCCCC1)C(F)(F)F |
| InChI | InChI=1S/C10H18F3NOS/c11-10(12,13)9(6-7-14)16(15)8-4-2-1-3-5-8/h8-9H,1-7,14H2 |
| InChIKey | GILSDMHRNLJMCT-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.32 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |