C8H16F3NOS — CID 81328435
3-tert-butylsulfinyl-4,4,4-trifluorobutan-1-amine (PubChem CID 81328435) has the molecular formula C8H16F3NOS and a molecular weight of 231.28 g/mol. Its IUPAC name is 3-tert-butylsulfinyl-4,4,4-trifluorobutan-1-amine.
| Compound Name | 3-tert-butylsulfinyl-4,4,4-trifluorobutan-1-amine |
|---|---|
| PubChem CID | 81328435 |
| Molecular Formula | C8H16F3NOS |
| Molecular Weight | 231.28 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | 3-tert-butylsulfinyl-4,4,4-trifluorobutan-1-amine |
| SMILES | CC(C)(C)S(=O)C(CCN)C(F)(F)F |
| InChI | InChI=1S/C8H16F3NOS/c1-7(2,3)14(13)6(4-5-12)8(9,10)11/h6H,4-5,12H2,1-3H3 |
| InChIKey | BORHORNTSJCVTR-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.28 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |