C10H12N2O3 — CID 103373421
2,3-dihydrofuran-5-yl-(6-methoxypyridazin-3-yl)methanol (PubChem CID 103373421) has the molecular formula C10H12N2O3 and a molecular weight of 208.22 g/mol. Its IUPAC name is 2,3-dihydrofuran-5-yl-(6-methoxypyridazin-3-yl)methanol.
| Compound Name | 2,3-dihydrofuran-5-yl-(6-methoxypyridazin-3-yl)methanol |
|---|---|
| PubChem CID | 103373421 |
| Molecular Formula | C10H12N2O3 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | 2,3-dihydrofuran-5-yl-(6-methoxypyridazin-3-yl)methanol |
| SMILES | COc1ccc(C(O)C2=CCCO2)nn1 |
| InChI | InChI=1S/C10H12N2O3/c1-14-9-5-4-7(11-12-9)10(13)8-3-2-6-15-8/h3-5,10,13H,2,6H2,1H3 |
| InChIKey | OGLVKUGTGDETBL-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 64.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |