C8H12BrNO2S — CID 103376804
2-[2-amino-1-(3-bromothiophen-2-yl)ethoxy]ethanol (PubChem CID 103376804) has the molecular formula C8H12BrNO2S and a molecular weight of 266.16 g/mol. Its IUPAC name is 2-[2-amino-1-(3-bromothiophen-2-yl)ethoxy]ethanol.
| Compound Name | 2-[2-amino-1-(3-bromothiophen-2-yl)ethoxy]ethanol |
|---|---|
| PubChem CID | 103376804 |
| Molecular Formula | C8H12BrNO2S |
| Molecular Weight | 266.16 g/mol |
| Exact Mass | 264.98 |
| IUPAC Name | 2-[2-amino-1-(3-bromothiophen-2-yl)ethoxy]ethanol |
| SMILES | NCC(OCCO)c1sccc1Br |
| InChI | InChI=1S/C8H12BrNO2S/c9-6-1-4-13-8(6)7(5-10)12-3-2-11/h1,4,7,11H,2-3,5,10H2 |
| InChIKey | APDSAAMNDOCNAF-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.16 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |