C14H18N4OS — CID 103379227
3-amino-5-(4-phenylbutan-2-ylamino)-1,2-thiazole-4-carboxamide (PubChem CID 103379227) has the molecular formula C14H18N4OS and a molecular weight of 290.39 g/mol. Its IUPAC name is 3-amino-5-(4-phenylbutan-2-ylamino)-1,2-thiazole-4-carboxamide.
| Compound Name | 3-amino-5-(4-phenylbutan-2-ylamino)-1,2-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 103379227 |
| Molecular Formula | C14H18N4OS |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 3-amino-5-(4-phenylbutan-2-ylamino)-1,2-thiazole-4-carboxamide |
| SMILES | CC(CCc1ccccc1)Nc1snc(N)c1C(N)=O |
| InChI | InChI=1S/C14H18N4OS/c1-9(7-8-10-5-3-2-4-6-10)17-14-11(13(16)19)12(15)18-20-14/h2-6,9,17H,7-8H2,1H3,(H2,15,18)(H2,16,19) |
| InChIKey | VGUSZZIRHPGCNY-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |