C14H17N3O2S2 — CID 103379933
4-methylsulfonyl-5-N-(1,2,3,4-tetrahydronaphthalen-1-yl)-1,2-thiazole-3,5-diamine (PubChem CID 103379933) has the molecular formula C14H17N3O2S2 and a molecular weight of 323.44 g/mol. Its IUPAC name is 4-methylsulfonyl-5-N-(1,2,3,4-tetrahydronaphthalen-1-yl)-1,2-thiazole-3,5-diamine.
| Compound Name | 4-methylsulfonyl-5-N-(1,2,3,4-tetrahydronaphthalen-1-yl)-1,2-thiazole-3,5-diamine |
|---|---|
| PubChem CID | 103379933 |
| Molecular Formula | C14H17N3O2S2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | 4-methylsulfonyl-5-N-(1,2,3,4-tetrahydronaphthalen-1-yl)-1,2-thiazole-3,5-diamine |
| SMILES | CS(=O)(=O)c1c(N)nsc1NC1CCCc2ccccc21 |
| InChI | InChI=1S/C14H17N3O2S2/c1-21(18,19)12-13(15)17-20-14(12)16-11-8-4-6-9-5-2-3-7-10(9)11/h2-3,5,7,11,16H,4,6,8H2,1H3,(H2,15,17) |
| InChIKey | DGXNEWKKHYDZCG-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |