C17H21N3 — CID 103386655
2-(1,10,10-trimethyl-3,5-diazatricyclo[5.2.1.02,6]deca-2(6),3-dien-4-yl)aniline (PubChem CID 103386655) has the molecular formula C17H21N3 and a molecular weight of 267.38 g/mol. Its IUPAC name is 2-(1,10,10-trimethyl-3,5-diazatricyclo[5.2.1.02,6]deca-2(6),3-dien-4-yl)aniline.
| Compound Name | 2-(1,10,10-trimethyl-3,5-diazatricyclo[5.2.1.02,6]deca-2(6),3-dien-4-yl)aniline |
|---|---|
| PubChem CID | 103386655 |
| Molecular Formula | C17H21N3 |
| Molecular Weight | 267.38 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | 2-(1,10,10-trimethyl-3,5-diazatricyclo[5.2.1.02,6]deca-2(6),3-dien-4-yl)aniline |
| SMILES | CC12CCC(c3[nH]c(-c4ccccc4N)nc31)C2(C)C |
| InChI | InChI=1S/C17H21N3/c1-16(2)11-8-9-17(16,3)14-13(11)19-15(20-14)10-6-4-5-7-12(10)18/h4-7,11H,8-9,18H2,1-3H3,(H,19,20) |
| InChIKey | CTSOVXCKJHHGGP-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.38 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|