C19H23N3 — CID 150532815
1,11,11-trimethyl-6-(2-methylphenyl)-3,5-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-4-amine (PubChem CID 150532815) has the molecular formula C19H23N3 and a molecular weight of 293.41 g/mol. Its IUPAC name is 1,11,11-trimethyl-6-(2-methylphenyl)-3,5-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-4-amine.
| Compound Name | 1,11,11-trimethyl-6-(2-methylphenyl)-3,5-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-4-amine |
|---|---|
| PubChem CID | 150532815 |
| Molecular Formula | C19H23N3 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.19 |
| IUPAC Name | 1,11,11-trimethyl-6-(2-methylphenyl)-3,5-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-4-amine |
| SMILES | Cc1ccccc1-c1nc(N)nc2c1C1CCC2(C)C1(C)C |
| InChI | InChI=1S/C19H23N3/c1-11-7-5-6-8-12(11)15-14-13-9-10-19(4,18(13,2)3)16(14)22-17(20)21-15/h5-8,13H,9-10H2,1-4H3,(H2,20,21,22) |
| InChIKey | IEEYQQCBTSVACW-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |