C25H33N3 — CID 66492613
4-(3,5-dimethylpiperidin-1-yl)-1,11,11-trimethyl-6-phenyl-3,5-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene (PubChem CID 66492613) has the molecular formula C25H33N3 and a molecular weight of 375.56 g/mol. Its IUPAC name is 4-(3,5-dimethylpiperidin-1-yl)-1,11,11-trimethyl-6-phenyl-3,5-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene.
| Compound Name | 4-(3,5-dimethylpiperidin-1-yl)-1,11,11-trimethyl-6-phenyl-3,5-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene |
|---|---|
| PubChem CID | 66492613 |
| Molecular Formula | C25H33N3 |
| Molecular Weight | 375.56 g/mol |
| Exact Mass | 375.27 |
| IUPAC Name | 4-(3,5-dimethylpiperidin-1-yl)-1,11,11-trimethyl-6-phenyl-3,5-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene |
| SMILES | CC1CC(C)CN(c2nc(-c3ccccc3)c3c(n2)C2(C)CCC3C2(C)C)C1 |
| InChI | InChI=1S/C25H33N3/c1-16-13-17(2)15-28(14-16)23-26-21(18-9-7-6-8-10-18)20-19-11-12-25(5,22(20)27-23)24(19,3)4/h6-10,16-17,19H,11-15H2,1-5H3 |
| InChIKey | BJXXTKIJSDPOSZ-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.56 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |