C26H25N3O — CID 101085764
(1S,11R)-11,14,14-trimethyl-6,7-diphenyl-3,4,8-triazatetracyclo[9.2.1.02,10.04,8]tetradeca-2,6,9-trien-5-one (PubChem CID 101085764) has the molecular formula C26H25N3O and a molecular weight of 395.51 g/mol. Its IUPAC name is (1S,11R)-11,14,14-trimethyl-6,7-diphenyl-3,4,8-triazatetracyclo[9.2.1.02,10.04,8]tetradeca-2,6,9-trien-5-one.
| Compound Name | (1S,11R)-11,14,14-trimethyl-6,7-diphenyl-3,4,8-triazatetracyclo[9.2.1.02,10.04,8]tetradeca-2,6,9-trien-5-one |
|---|---|
| PubChem CID | 101085764 |
| Molecular Formula | C26H25N3O |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | (1S,11R)-11,14,14-trimethyl-6,7-diphenyl-3,4,8-triazatetracyclo[9.2.1.02,10.04,8]tetradeca-2,6,9-trien-5-one |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(C)c1cn3c(-c4ccccc4)c(-c4ccccc4)c(=O)n3nc12 |
| InChI | InChI=1S/C26H25N3O/c1-25(2)19-14-15-26(25,3)20-16-28-23(18-12-8-5-9-13-18)21(17-10-6-4-7-11-17)24(30)29(28)27-22(19)20/h4-13,16,19H,14-15H2,1-3H3/t19-,26+/m1/s1 |
| InChIKey | JTXFRBLUQGOQOO-BCHFMIIMSA-N |
| XLogP | 5.30 |
| TPSA | 38.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |