C16H11BrN2O4 — CID 10499684
6-bromo-7-methoxy-1-methyl-3-phenylquinoxaline-2,5,8-trione (PubChem CID 10499684) has the molecular formula C16H11BrN2O4 and a molecular weight of 375.18 g/mol. Its IUPAC name is 6-bromo-7-methoxy-1-methyl-3-phenylquinoxaline-2,5,8-trione.
| Compound Name | 6-bromo-7-methoxy-1-methyl-3-phenylquinoxaline-2,5,8-trione |
|---|---|
| PubChem CID | 10499684 |
| Molecular Formula | C16H11BrN2O4 |
| Molecular Weight | 375.18 g/mol |
| Exact Mass | 373.99 |
| IUPAC Name | 6-bromo-7-methoxy-1-methyl-3-phenylquinoxaline-2,5,8-trione |
| SMILES | COC1=C(Br)C(=O)c2nc(-c3ccccc3)c(=O)n(C)c2C1=O |
| InChI | InChI=1S/C16H11BrN2O4/c1-19-12-11(13(20)9(17)15(23-2)14(12)21)18-10(16(19)22)8-6-4-3-5-7-8/h3-7H,1-2H3 |
| InChIKey | SFPWCJIKNKQKRM-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 78.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.18 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|