C17H27N3O — CID 103387611
4-N-(3-indol-1-ylpropyl)-5-methoxypentane-1,4-diamine (PubChem CID 103387611) has the molecular formula C17H27N3O and a molecular weight of 289.42 g/mol. Its IUPAC name is 4-N-(3-indol-1-ylpropyl)-5-methoxypentane-1,4-diamine.
| Compound Name | 4-N-(3-indol-1-ylpropyl)-5-methoxypentane-1,4-diamine |
|---|---|
| PubChem CID | 103387611 |
| Molecular Formula | C17H27N3O |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.22 |
| IUPAC Name | 4-N-(3-indol-1-ylpropyl)-5-methoxypentane-1,4-diamine |
| SMILES | COCC(CCCN)NCCCn1ccc2ccccc21 |
| InChI | InChI=1S/C17H27N3O/c1-21-14-16(7-4-10-18)19-11-5-12-20-13-9-15-6-2-3-8-17(15)20/h2-3,6,8-9,13,16,19H,4-5,7,10-12,14,18H2,1H3 |
| InChIKey | BDGCKPQWIHVQSB-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 52.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|