C16H34N4O3 — CID 103390751
tert-butyl N-[5-methoxy-4-[(4-methylpiperazin-1-yl)amino]pentyl]carbamate (PubChem CID 103390751) has the molecular formula C16H34N4O3 and a molecular weight of 330.47 g/mol. Its IUPAC name is tert-butyl N-[5-methoxy-4-[(4-methylpiperazin-1-yl)amino]pentyl]carbamate.
| Compound Name | tert-butyl N-[5-methoxy-4-[(4-methylpiperazin-1-yl)amino]pentyl]carbamate |
|---|---|
| PubChem CID | 103390751 |
| Molecular Formula | C16H34N4O3 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.26 |
| IUPAC Name | tert-butyl N-[5-methoxy-4-[(4-methylpiperazin-1-yl)amino]pentyl]carbamate |
| SMILES | COCC(CCCNC(=O)OC(C)(C)C)NN1CCN(C)CC1 |
| InChI | InChI=1S/C16H34N4O3/c1-16(2,3)23-15(21)17-8-6-7-14(13-22-5)18-20-11-9-19(4)10-12-20/h14,18H,6-13H2,1-5H3,(H,17,21) |
| InChIKey | MJRVIXZYRXCILU-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 66.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|