C18H28O6S — CID 10339257
ethyl (2R,3R,4S)-2-(benzenesulfonyl)-4-(methoxymethoxy)-3,5-dimethylhexanoate (PubChem CID 10339257) has the molecular formula C18H28O6S and a molecular weight of 372.48 g/mol. Its IUPAC name is ethyl (2R,3R,4S)-2-(benzenesulfonyl)-4-(methoxymethoxy)-3,5-dimethylhexanoate.
| Compound Name | ethyl (2R,3R,4S)-2-(benzenesulfonyl)-4-(methoxymethoxy)-3,5-dimethylhexanoate |
|---|---|
| PubChem CID | 10339257 |
| Molecular Formula | C18H28O6S |
| Molecular Weight | 372.48 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | ethyl (2R,3R,4S)-2-(benzenesulfonyl)-4-(methoxymethoxy)-3,5-dimethylhexanoate |
| SMILES | CCOC(=O)[C@@H]([C@H](C)[C@@H](OCOC)C(C)C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H28O6S/c1-6-23-18(19)17(14(4)16(13(2)3)24-12-22-5)25(20,21)15-10-8-7-9-11-15/h7-11,13-14,16-17H,6,12H2,1-5H3/t14-,16+,17-/m1/s1 |
| InChIKey | ZLXYPXLQQYHKFO-HYVNUMGLSA-N |
| XLogP | 2.67 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.48 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|