C13H18ClF2NO — CID 103392697
4-[(2-chloro-3-fluorophenyl)methyl]-4-fluoro-5-methoxypentan-1-amine (PubChem CID 103392697) has the molecular formula C13H18ClF2NO and a molecular weight of 277.74 g/mol. Its IUPAC name is 4-[(2-chloro-3-fluorophenyl)methyl]-4-fluoro-5-methoxypentan-1-amine.
| Compound Name | 4-[(2-chloro-3-fluorophenyl)methyl]-4-fluoro-5-methoxypentan-1-amine |
|---|---|
| PubChem CID | 103392697 |
| Molecular Formula | C13H18ClF2NO |
| Molecular Weight | 277.74 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | 4-[(2-chloro-3-fluorophenyl)methyl]-4-fluoro-5-methoxypentan-1-amine |
| SMILES | COCC(F)(CCCN)Cc1cccc(F)c1Cl |
| InChI | InChI=1S/C13H18ClF2NO/c1-18-9-13(16,6-3-7-17)8-10-4-2-5-11(15)12(10)14/h2,4-5H,3,6-9,17H2,1H3 |
| InChIKey | FQJGWVIZQHNMNU-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.74 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |