C24H36O3 — CID 10339273
(5S,8R,9S,10R,13S,14S)-13-methyl-10-(oxan-2-yloxymethyl)-1,2,5,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one (PubChem CID 10339273) has the molecular formula C24H36O3 and a molecular weight of 372.55 g/mol. Its IUPAC name is (5S,8R,9S,10R,13S,14S)-13-methyl-10-(oxan-2-yloxymethyl)-1,2,5,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one.
| Compound Name | (5S,8R,9S,10R,13S,14S)-13-methyl-10-(oxan-2-yloxymethyl)-1,2,5,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 10339273 |
| Molecular Formula | C24H36O3 |
| Molecular Weight | 372.55 g/mol |
| Exact Mass | 372.27 |
| IUPAC Name | (5S,8R,9S,10R,13S,14S)-13-methyl-10-(oxan-2-yloxymethyl)-1,2,5,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one |
| SMILES | C[C@]12CC[C@H]3[C@@H](CC[C@H]4C=CCC[C@@]43COC3CCCCO3)[C@@H]1CCC2=O |
| InChI | InChI=1S/C24H36O3/c1-23-14-12-20-18(19(23)10-11-21(23)25)9-8-17-6-2-4-13-24(17,20)16-27-22-7-3-5-15-26-22/h2,6,17-20,22H,3-5,7-16H2,1H3/t17-,18+,19+,20+,22?,23+,24-/m1/s1 |
| InChIKey | FNSQDWJJANGSKF-XBCRANRMSA-N |
| XLogP | 5.29 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.55 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|