C26H38O3S2 — CID 54395899
(8'R,9'S,10'R,13'S,14'S)-2',13'-dimethyl-2'-(oxan-2-yloxy)spiro[1,3-dithiolane-2,3'-6,7,8,9,10,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene]-17'-one (PubChem CID 54395899) has the molecular formula C26H38O3S2 and a molecular weight of 462.72 g/mol. Its IUPAC name is (8'R,9'S,10'R,13'S,14'S)-2',13'-dimethyl-2'-(oxan-2-yloxy)spiro[1,3-dithiolane-2,3'-6,7,8,9,10,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene]-17'-one.
| Compound Name | (8'R,9'S,10'R,13'S,14'S)-2',13'-dimethyl-2'-(oxan-2-yloxy)spiro[1,3-dithiolane-2,3'-6,7,8,9,10,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene]-17'-one |
|---|---|
| PubChem CID | 54395899 |
| Molecular Formula | C26H38O3S2 |
| Molecular Weight | 462.72 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | (8'R,9'S,10'R,13'S,14'S)-2',13'-dimethyl-2'-(oxan-2-yloxy)spiro[1,3-dithiolane-2,3'-6,7,8,9,10,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene]-17'-one |
| SMILES | CC1(OC2CCCCO2)C[C@H]2C(=CC13SCCS3)CC[C@@H]1[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C26H38O3S2/c1-24-11-10-18-19(21(24)8-9-22(24)27)7-6-17-15-26(30-13-14-31-26)25(2,16-20(17)18)29-23-5-3-4-12-28-23/h15,18-21,23H,3-14,16H2,1-2H3/t18-,19+,20-,21-,23?,24-,25?/m0/s1 |
| InChIKey | VJXPLZOVYQECTA-URLZZUGASA-N |
| XLogP | 6.22 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.72 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|