C19H26N4O2S — CID 10339400
2-N-(2-aminophenyl)-5-N-[3-(dimethylamino)-2,2-dimethylpropyl]thiophene-2,5-dicarboxamide (PubChem CID 10339400) has the molecular formula C19H26N4O2S and a molecular weight of 374.51 g/mol. Its IUPAC name is 2-N-(2-aminophenyl)-5-N-[3-(dimethylamino)-2,2-dimethylpropyl]thiophene-2,5-dicarboxamide.
| Compound Name | 2-N-(2-aminophenyl)-5-N-[3-(dimethylamino)-2,2-dimethylpropyl]thiophene-2,5-dicarboxamide |
|---|---|
| PubChem CID | 10339400 |
| Molecular Formula | C19H26N4O2S |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | 2-N-(2-aminophenyl)-5-N-[3-(dimethylamino)-2,2-dimethylpropyl]thiophene-2,5-dicarboxamide |
| SMILES | CN(C)CC(C)(C)CNC(=O)c1ccc(C(=O)Nc2ccccc2N)s1 |
| InChI | InChI=1S/C19H26N4O2S/c1-19(2,12-23(3)4)11-21-17(24)15-9-10-16(26-15)18(25)22-14-8-6-5-7-13(14)20/h5-10H,11-12,20H2,1-4H3,(H,21,24)(H,22,25) |
| InChIKey | LCHUJEHBQYUCNF-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|