C15H24FNO2 — CID 103395886
2-ethoxy-2-ethyl-1-(2-fluoro-4-methoxyphenyl)butan-1-amine (PubChem CID 103395886) has the molecular formula C15H24FNO2 and a molecular weight of 269.36 g/mol. Its IUPAC name is 2-ethoxy-2-ethyl-1-(2-fluoro-4-methoxyphenyl)butan-1-amine.
| Compound Name | 2-ethoxy-2-ethyl-1-(2-fluoro-4-methoxyphenyl)butan-1-amine |
|---|---|
| PubChem CID | 103395886 |
| Molecular Formula | C15H24FNO2 |
| Molecular Weight | 269.36 g/mol |
| Exact Mass | 269.18 |
| IUPAC Name | 2-ethoxy-2-ethyl-1-(2-fluoro-4-methoxyphenyl)butan-1-amine |
| SMILES | CCOC(CC)(CC)C(N)c1ccc(OC)cc1F |
| InChI | InChI=1S/C15H24FNO2/c1-5-15(6-2,19-7-3)14(17)12-9-8-11(18-4)10-13(12)16/h8-10,14H,5-7,17H2,1-4H3 |
| InChIKey | FKKBAXREVHPLMF-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.36 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |