C16H27NO3 — CID 116759700
1-(2,5-dimethoxyphenyl)-2-ethoxy-2-ethylbutan-1-amine (PubChem CID 116759700) has the molecular formula C16H27NO3 and a molecular weight of 281.40 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-2-ethoxy-2-ethylbutan-1-amine.
| Compound Name | 1-(2,5-dimethoxyphenyl)-2-ethoxy-2-ethylbutan-1-amine |
|---|---|
| PubChem CID | 116759700 |
| Molecular Formula | C16H27NO3 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.20 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-2-ethoxy-2-ethylbutan-1-amine |
| SMILES | CCOC(CC)(CC)C(N)c1cc(OC)ccc1OC |
| InChI | InChI=1S/C16H27NO3/c1-6-16(7-2,20-8-3)15(17)13-11-12(18-4)9-10-14(13)19-5/h9-11,15H,6-8,17H2,1-5H3 |
| InChIKey | SMYQAWPVXBNEAI-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |