C13H18N2O2 — CID 116940352
3-amino-3-(2,5-dimethoxyphenyl)-2,2-dimethylpropanenitrile (PubChem CID 116940352) has the molecular formula C13H18N2O2 and a molecular weight of 234.30 g/mol. Its IUPAC name is 3-amino-3-(2,5-dimethoxyphenyl)-2,2-dimethylpropanenitrile.
| Compound Name | 3-amino-3-(2,5-dimethoxyphenyl)-2,2-dimethylpropanenitrile |
|---|---|
| PubChem CID | 116940352 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 3-amino-3-(2,5-dimethoxyphenyl)-2,2-dimethylpropanenitrile |
| SMILES | COc1ccc(OC)c(C(N)C(C)(C)C#N)c1 |
| InChI | InChI=1S/C13H18N2O2/c1-13(2,8-14)12(15)10-7-9(16-3)5-6-11(10)17-4/h5-7,12H,15H2,1-4H3 |
| InChIKey | MGSYKHUGXHKJDX-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 68.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |